About 3-iminothiolan-2-amine
3-iminothiolan-2-amine (PubChem CID 140585741) has the molecular formula C4H8N2S
and a molecular weight of 116.19 g/mol. Its IUPAC name is 3-iminothiolan-2-amine.
Molecular Properties
| Compound Name | 3-iminothiolan-2-amine |
| PubChem CID | 140585741 |
| Molecular Formula | C4H8N2S |
| Molecular Weight | 116.19 g/mol |
| Exact Mass | 116.04 |
| IUPAC Name | 3-iminothiolan-2-amine |
| SMILES | [H]/N=C1\CCSC1N |
| InChI | InChI=1S/C4H8N2S/c5-3-1-2-7-4(3)6/h4-5H,1-2,6H2/b5-3+ |
| InChIKey | PYJSWRKFCSPTFG-HWKANZROSA-N |
| XLogP | 0.43 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.19 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-iminothiolan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iminothiolan-2-amine?
The IUPAC name of 3-iminothiolan-2-amine (CID 140585741) is 3-iminothiolan-2-amine.
What is the SMILES notation for 3-iminothiolan-2-amine?
The canonical SMILES for 3-iminothiolan-2-amine is [H]/N=C1\CCSC1N.
What is the InChIKey of 3-iminothiolan-2-amine?
The InChIKey is PYJSWRKFCSPTFG-HWKANZROSA-N. The full InChI is InChI=1S/C4H8N2S/c5-3-1-2-7-4(3)6/h4-5H,1-2,6H2/b5-3+.
What are the key properties of 3-iminothiolan-2-amine?
3-iminothiolan-2-amine has a molecular weight of 116.19 g/mol, XLogP of 0.43, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iminothiolan-2-amine is sourced from PubChem (CID 140585741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).