C9H15NS2 — CID 92523978
(3aS,9aR)-3a,4,5,6,7,8,9,9a-octahydrocycloocta[d][1,3]dithiol-2-imine (PubChem CID 92523978) has the molecular formula C9H15NS2 and a molecular weight of 201.36 g/mol. Its IUPAC name is (3aS,9aR)-3a,4,5,6,7,8,9,9a-octahydrocycloocta[d][1,3]dithiol-2-imine.
| Compound Name | (3aS,9aR)-3a,4,5,6,7,8,9,9a-octahydrocycloocta[d][1,3]dithiol-2-imine |
|---|---|
| PubChem CID | 92523978 |
| Molecular Formula | C9H15NS2 |
| Molecular Weight | 201.36 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | (3aS,9aR)-3a,4,5,6,7,8,9,9a-octahydrocycloocta[d][1,3]dithiol-2-imine |
| SMILES | [H]/N=C1\S[C@H]2CCCCCC[C@H]2S1 |
| InChI | InChI=1S/C9H15NS2/c10-9-11-7-5-3-1-2-4-6-8(7)12-9/h7-8,10H,1-6H2/b10-9-/t7-,8+/m1/s1 |
| InChIKey | BNADQSGHSXOPSJ-TWEHFBLQSA-N |
| XLogP | 3.49 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.36 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|