C8H10O2S — CID 131859624
(3aS,7aS)-5,6,7,7a-tetrahydro-3aH-1-benzothiophene-3,4-dione (PubChem CID 131859624) has the molecular formula C8H10O2S and a molecular weight of 170.23 g/mol. Its IUPAC name is (3aS,7aS)-5,6,7,7a-tetrahydro-3aH-1-benzothiophene-3,4-dione.
| Compound Name | (3aS,7aS)-5,6,7,7a-tetrahydro-3aH-1-benzothiophene-3,4-dione |
|---|---|
| PubChem CID | 131859624 |
| Molecular Formula | C8H10O2S |
| Molecular Weight | 170.23 g/mol |
| Exact Mass | 170.04 |
| IUPAC Name | (3aS,7aS)-5,6,7,7a-tetrahydro-3aH-1-benzothiophene-3,4-dione |
| SMILES | O=C1CCC[C@@H]2SCC(=O)[C@H]12 |
| InChI | InChI=1S/C8H10O2S/c9-5-2-1-3-7-8(5)6(10)4-11-7/h7-8H,1-4H2/t7-,8-/m0/s1 |
| InChIKey | GQLYSHKYJSXTNB-YUMQZZPRSA-N |
| XLogP | 1.04 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.23 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|