C9H9NO4 — CID 18377854
5,6,7,8a-tetrahydro-3aH-cyclohepta[c]pyrrole-1,3,4,8-tetrone (PubChem CID 18377854) has the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. Its IUPAC name is 5,6,7,8a-tetrahydro-3aH-cyclohepta[c]pyrrole-1,3,4,8-tetrone.
| Compound Name | 5,6,7,8a-tetrahydro-3aH-cyclohepta[c]pyrrole-1,3,4,8-tetrone |
|---|---|
| PubChem CID | 18377854 |
| Molecular Formula | C9H9NO4 |
| Molecular Weight | 195.17 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 5,6,7,8a-tetrahydro-3aH-cyclohepta[c]pyrrole-1,3,4,8-tetrone |
| SMILES | O=C1CCCC(=O)C2C(=O)NC(=O)C12 |
| InChI | InChI=1S/C9H9NO4/c11-4-2-1-3-5(12)7-6(4)8(13)10-9(7)14/h6-7H,1-3H2,(H,10,13,14) |
| InChIKey | FRTBDSCNSDMYQK-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.17 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|