C10H14O2 — CID 13115377
bicyclo[5.2.1]decane-2,6-dione (PubChem CID 13115377) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is bicyclo[5.2.1]decane-2,6-dione.
| Compound Name | bicyclo[5.2.1]decane-2,6-dione |
|---|---|
| PubChem CID | 13115377 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | bicyclo[5.2.1]decane-2,6-dione |
| SMILES | O=C1CCCC(=O)C2CCC1C2 |
| InChI | InChI=1S/C10H14O2/c11-9-2-1-3-10(12)8-5-4-7(9)6-8/h7-8H,1-6H2 |
| InChIKey | YNAORWONHPHXIG-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |