C7H10O3 — CID 130028608
2-(hydroxymethyl)cyclohexane-1,3-dione (PubChem CID 130028608) has the molecular formula C7H10O3 and a molecular weight of 142.15 g/mol. Its IUPAC name is 2-(hydroxymethyl)cyclohexane-1,3-dione.
| Compound Name | 2-(hydroxymethyl)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 130028608 |
| Molecular Formula | C7H10O3 |
| Molecular Weight | 142.15 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | 2-(hydroxymethyl)cyclohexane-1,3-dione |
| SMILES | O=C1CCCC(=O)C1CO |
| InChI | InChI=1S/C7H10O3/c8-4-5-6(9)2-1-3-7(5)10/h5,8H,1-4H2 |
| InChIKey | JKEXTEDJMSBRNN-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.15 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|