C26H26O2S3 — CID 102268225
trans-(2S,3R)-2-(hydroxymethyl)-3-[tris(phenylsulfanyl)methyl]cyclohexan-1-one (PubChem CID 102268225) has the molecular formula C26H26O2S3 and a molecular weight of 466.69 g/mol. Its IUPAC name is trans-(2S,3R)-2-(hydroxymethyl)-3-[tris(phenylsulfanyl)methyl]cyclohexan-1-one.
| Compound Name | trans-(2S,3R)-2-(hydroxymethyl)-3-[tris(phenylsulfanyl)methyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 102268225 |
| Molecular Formula | C26H26O2S3 |
| Molecular Weight | 466.69 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | trans-(2S,3R)-2-(hydroxymethyl)-3-[tris(phenylsulfanyl)methyl]cyclohexan-1-one |
| SMILES | O=C1CCC[C@@H](C(Sc2ccccc2)(Sc2ccccc2)Sc2ccccc2)[C@H]1CO |
| InChI | InChI=1S/C26H26O2S3/c27-19-23-24(17-10-18-25(23)28)26(29-20-11-4-1-5-12-20,30-21-13-6-2-7-14-21)31-22-15-8-3-9-16-22/h1-9,11-16,23-24,27H,10,17-19H2/t23-,24-/m1/s1 |
| InChIKey | POBQIVSNWWBMFF-DNQXCXABSA-N |
| XLogP | 6.99 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.69 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|