C14H16OS — CID 10243046
trans-(2R,3R)-3-ethenyl-2-(phenylsulfanylmethyl)cyclopentan-1-one (PubChem CID 10243046) has the molecular formula C14H16OS and a molecular weight of 232.35 g/mol. Its IUPAC name is trans-(2R,3R)-3-ethenyl-2-(phenylsulfanylmethyl)cyclopentan-1-one.
| Compound Name | trans-(2R,3R)-3-ethenyl-2-(phenylsulfanylmethyl)cyclopentan-1-one |
|---|---|
| PubChem CID | 10243046 |
| Molecular Formula | C14H16OS |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | trans-(2R,3R)-3-ethenyl-2-(phenylsulfanylmethyl)cyclopentan-1-one |
| SMILES | C=C[C@H]1CCC(=O)[C@@H]1CSc1ccccc1 |
| InChI | InChI=1S/C14H16OS/c1-2-11-8-9-14(15)13(11)10-16-12-6-4-3-5-7-12/h2-7,11,13H,1,8-10H2/t11-,13+/m0/s1 |
| InChIKey | GTXBKYWMGQDVTL-WCQYABFASA-N |
| XLogP | 3.56 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|