C23H32O3S3 — CID 102027936
1-S,3-S-ditert-butyl 2-[(1R,2S)-3-oxo-2-(phenylsulfanylmethyl)cyclopentyl]propanebis(thioate) (PubChem CID 102027936) has the molecular formula C23H32O3S3 and a molecular weight of 452.71 g/mol. Its IUPAC name is 1-S,3-S-ditert-butyl 2-[(1R,2S)-3-oxo-2-(phenylsulfanylmethyl)cyclopentyl]propanebis(thioate).
| Compound Name | 1-S,3-S-ditert-butyl 2-[(1R,2S)-3-oxo-2-(phenylsulfanylmethyl)cyclopentyl]propanebis(thioate) |
|---|---|
| PubChem CID | 102027936 |
| Molecular Formula | C23H32O3S3 |
| Molecular Weight | 452.71 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | 1-S,3-S-ditert-butyl 2-[(1R,2S)-3-oxo-2-(phenylsulfanylmethyl)cyclopentyl]propanebis(thioate) |
| SMILES | CC(C)(C)SC(=O)C(C(=O)SC(C)(C)C)[C@@H]1CCC(=O)[C@H]1CSc1ccccc1 |
| InChI | InChI=1S/C23H32O3S3/c1-22(2,3)28-20(25)19(21(26)29-23(4,5)6)16-12-13-18(24)17(16)14-27-15-10-8-7-9-11-15/h7-11,16-17,19H,12-14H2,1-6H3/t16-,17+/m1/s1 |
| InChIKey | QIDPMFZGRTUCFY-SJORKVTESA-N |
| XLogP | 6.11 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.71 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|