3-(phenylsulfanylmethyl)pyrrolidine;2,2,2-trifluoroacetic acid

C13H16F3NO2S — CID 23184280

IUPAC3-(phenylsulfanylmethyl)pyrrolidine;2,2,2-trifluoroacetic acid
SMILESO=C(O)C(F)(F)F.c1ccc(SCC2CCNC2)cc1
InChIInChI=1S/C11H15NS.C2HF3O2/c1-2-4-11(5-3-1)13-9-10-6-7-12-8-10;3-2(4,5)1(6)7/h1-5,10,12H,6-9H2;(H,6,7)
InChIKeyUZXVIDMLFMJWRB-UHFFFAOYSA-N
MW307.34 g/mol
LogP3.02
Rot. Bonds3

About 3-(phenylsulfanylmethyl)pyrrolidine;2,2,2-trifluoroacetic acid

3-(phenylsulfanylmethyl)pyrrolidine;2,2,2-trifluoroacetic acid (PubChem CID 23184280) has the molecular formula C13H16F3NO2S and a molecular weight of 307.34 g/mol. Its IUPAC name is 3-(phenylsulfanylmethyl)pyrrolidine;2,2,2-trifluoroacetic acid.

Molecular Properties

Compound Name3-(phenylsulfanylmethyl)pyrrolidine;2,2,2-trifluoroacetic acid
PubChem CID23184280
Molecular FormulaC13H16F3NO2S
Molecular Weight307.34 g/mol
Exact Mass307.09
IUPAC Name3-(phenylsulfanylmethyl)pyrrolidine;2,2,2-trifluoroacetic acid
SMILESO=C(O)C(F)(F)F.c1ccc(SCC2CCNC2)cc1
InChIInChI=1S/C11H15NS.C2HF3O2/c1-2-4-11(5-3-1)13-9-10-6-7-12-8-10;3-2(4,5)1(6)7/h1-5,10,12H,6-9H2;(H,6,7)
InChIKeyUZXVIDMLFMJWRB-UHFFFAOYSA-N
XLogP3.02
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500307.34
LogP ≤ 53.02
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 3-(phenylsulfanylmethyl)pyrrolidine;2,2,2-trifluoroacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(phenylsulfanylmethyl)pyrrolidine;2,2,2-trifluoroacetic acid?
The IUPAC name of 3-(phenylsulfanylmethyl)pyrrolidine;2,2,2-trifluoroacetic acid (CID 23184280) is 3-(phenylsulfanylmethyl)pyrrolidine;2,2,2-trifluoroacetic acid.
What is the SMILES notation for 3-(phenylsulfanylmethyl)pyrrolidine;2,2,2-trifluoroacetic acid?
The canonical SMILES for 3-(phenylsulfanylmethyl)pyrrolidine;2,2,2-trifluoroacetic acid is O=C(O)C(F)(F)F.c1ccc(SCC2CCNC2)cc1.
What is the InChIKey of 3-(phenylsulfanylmethyl)pyrrolidine;2,2,2-trifluoroacetic acid?
The InChIKey is UZXVIDMLFMJWRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NS.C2HF3O2/c1-2-4-11(5-3-1)13-9-10-6-7-12-8-10;3-2(4,5)1(6)7/h1-5,10,12H,6-9H2;(H,6,7).
What are the key properties of 3-(phenylsulfanylmethyl)pyrrolidine;2,2,2-trifluoroacetic acid?
3-(phenylsulfanylmethyl)pyrrolidine;2,2,2-trifluoroacetic acid has a molecular weight of 307.34 g/mol, XLogP of 3.02, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(phenylsulfanylmethyl)pyrrolidine;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 23184280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).