C13H16F3NO2S — CID 23184280
3-(phenylsulfanylmethyl)pyrrolidine;2,2,2-trifluoroacetic acid (PubChem CID 23184280) has the molecular formula C13H16F3NO2S and a molecular weight of 307.34 g/mol. Its IUPAC name is 3-(phenylsulfanylmethyl)pyrrolidine;2,2,2-trifluoroacetic acid.
| Compound Name | 3-(phenylsulfanylmethyl)pyrrolidine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 23184280 |
| Molecular Formula | C13H16F3NO2S |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 3-(phenylsulfanylmethyl)pyrrolidine;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.c1ccc(SCC2CCNC2)cc1 |
| InChI | InChI=1S/C11H15NS.C2HF3O2/c1-2-4-11(5-3-1)13-9-10-6-7-12-8-10;3-2(4,5)1(6)7/h1-5,10,12H,6-9H2;(H,6,7) |
| InChIKey | UZXVIDMLFMJWRB-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |