(3S)-pyrrolidin-3-amine;2,2,2-trifluoroacetic acid

C6H11F3N2O2 — CID 172762354

IUPAC(3S)-pyrrolidin-3-amine;2,2,2-trifluoroacetic acid
SMILESN[C@H]1CCNC1.O=C(O)C(F)(F)F
InChIInChI=1S/C4H10N2.C2HF3O2/c5-4-1-2-6-3-4;3-2(4,5)1(6)7/h4,6H,1-3,5H2;(H,6,7)/t4-;/m0./s1
InChIKeyLVXWICNPBLPUAA-WCCKRBBISA-N
MW200.16 g/mol
LogP-0.06
Rot. Bonds

About (3S)-pyrrolidin-3-amine;2,2,2-trifluoroacetic acid

(3S)-pyrrolidin-3-amine;2,2,2-trifluoroacetic acid (PubChem CID 172762354) has the molecular formula C6H11F3N2O2 and a molecular weight of 200.16 g/mol. Its IUPAC name is (3S)-pyrrolidin-3-amine;2,2,2-trifluoroacetic acid.

Molecular Properties

Compound Name(3S)-pyrrolidin-3-amine;2,2,2-trifluoroacetic acid
PubChem CID172762354
Molecular FormulaC6H11F3N2O2
Molecular Weight200.16 g/mol
Exact Mass200.08
IUPAC Name(3S)-pyrrolidin-3-amine;2,2,2-trifluoroacetic acid
SMILESN[C@H]1CCNC1.O=C(O)C(F)(F)F
InChIInChI=1S/C4H10N2.C2HF3O2/c5-4-1-2-6-3-4;3-2(4,5)1(6)7/h4,6H,1-3,5H2;(H,6,7)/t4-;/m0./s1
InChIKeyLVXWICNPBLPUAA-WCCKRBBISA-N
XLogP-0.06
TPSA75.35 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.16
LogP ≤ 5-0.06
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze (3S)-pyrrolidin-3-amine;2,2,2-trifluoroacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3S)-pyrrolidin-3-amine;2,2,2-trifluoroacetic acid?
The IUPAC name of (3S)-pyrrolidin-3-amine;2,2,2-trifluoroacetic acid (CID 172762354) is (3S)-pyrrolidin-3-amine;2,2,2-trifluoroacetic acid.
What is the SMILES notation for (3S)-pyrrolidin-3-amine;2,2,2-trifluoroacetic acid?
The canonical SMILES for (3S)-pyrrolidin-3-amine;2,2,2-trifluoroacetic acid is N[C@H]1CCNC1.O=C(O)C(F)(F)F.
What is the InChIKey of (3S)-pyrrolidin-3-amine;2,2,2-trifluoroacetic acid?
The InChIKey is LVXWICNPBLPUAA-WCCKRBBISA-N. The full InChI is InChI=1S/C4H10N2.C2HF3O2/c5-4-1-2-6-3-4;3-2(4,5)1(6)7/h4,6H,1-3,5H2;(H,6,7)/t4-;/m0./s1.
What are the key properties of (3S)-pyrrolidin-3-amine;2,2,2-trifluoroacetic acid?
(3S)-pyrrolidin-3-amine;2,2,2-trifluoroacetic acid has a molecular weight of 200.16 g/mol, XLogP of -0.06, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-pyrrolidin-3-amine;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 172762354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).