C8H15F3N2O2 — CID 68531631
cyclohexane-1,4-diamine;2,2,2-trifluoroacetic acid (PubChem CID 68531631) has the molecular formula C8H15F3N2O2 and a molecular weight of 228.21 g/mol. Its IUPAC name is cyclohexane-1,4-diamine;2,2,2-trifluoroacetic acid.
| Compound Name | cyclohexane-1,4-diamine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 68531631 |
| Molecular Formula | C8H15F3N2O2 |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | cyclohexane-1,4-diamine;2,2,2-trifluoroacetic acid |
| SMILES | NC1CCC(N)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C6H14N2.C2HF3O2/c7-5-1-2-6(8)4-3-5;3-2(4,5)1(6)7/h5-6H,1-4,7-8H2;(H,6,7) |
| InChIKey | QFPKNVPPKGLACE-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |