C10H17F3N2O4S — CID 175545583
1-cyclopropylsulfonylpiperidin-4-amine;2,2,2-trifluoroacetic acid (PubChem CID 175545583) has the molecular formula C10H17F3N2O4S and a molecular weight of 318.32 g/mol. Its IUPAC name is 1-cyclopropylsulfonylpiperidin-4-amine;2,2,2-trifluoroacetic acid.
| Compound Name | 1-cyclopropylsulfonylpiperidin-4-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175545583 |
| Molecular Formula | C10H17F3N2O4S |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 1-cyclopropylsulfonylpiperidin-4-amine;2,2,2-trifluoroacetic acid |
| SMILES | NC1CCN(S(=O)(=O)C2CC2)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C8H16N2O2S.C2HF3O2/c9-7-3-5-10(6-4-7)13(11,12)8-1-2-8;3-2(4,5)1(6)7/h7-8H,1-6,9H2;(H,6,7) |
| InChIKey | UMXHOSFTXWRFDO-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |