C28H40O4S2 — CID 101362530
S-tert-butyl (5S)-5,6-dihydroxy-6-methyl-2-[(7S)-7-methyl-5-oxo-4-phenylsulfanyl-1,2,3,6,7,7a-hexahydroinden-1-yl]heptanethioate (PubChem CID 101362530) has the molecular formula C28H40O4S2 and a molecular weight of 504.76 g/mol. Its IUPAC name is S-tert-butyl (5S)-5,6-dihydroxy-6-methyl-2-[(7S)-7-methyl-5-oxo-4-phenylsulfanyl-1,2,3,6,7,7a-hexahydroinden-1-yl]heptanethioate.
| Compound Name | S-tert-butyl (5S)-5,6-dihydroxy-6-methyl-2-[(7S)-7-methyl-5-oxo-4-phenylsulfanyl-1,2,3,6,7,7a-hexahydroinden-1-yl]heptanethioate |
|---|---|
| PubChem CID | 101362530 |
| Molecular Formula | C28H40O4S2 |
| Molecular Weight | 504.76 g/mol |
| Exact Mass | 504.24 |
| IUPAC Name | S-tert-butyl (5S)-5,6-dihydroxy-6-methyl-2-[(7S)-7-methyl-5-oxo-4-phenylsulfanyl-1,2,3,6,7,7a-hexahydroinden-1-yl]heptanethioate |
| SMILES | C[C@H]1CC(=O)C(Sc2ccccc2)=C2CCC(C(CC[C@H](O)C(C)(C)O)C(=O)SC(C)(C)C)C21 |
| InChI | InChI=1S/C28H40O4S2/c1-17-16-22(29)25(33-18-10-8-7-9-11-18)21-13-12-19(24(17)21)20(26(31)34-27(2,3)4)14-15-23(30)28(5,6)32/h7-11,17,19-20,23-24,30,32H,12-16H2,1-6H3/t17-,19?,20?,23-,24?/m0/s1 |
| InChIKey | YSIYYYJOURMJNJ-AKTIPHJZSA-N |
| XLogP | 6.25 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.76 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|