C28H40O2S2 — CID 11113485
S-tert-butyl (2R)-2-[(5S,7aR)-5-hydroxy-7a-methyl-4-phenylsulfanyl-1,2,3,5,6,7-hexahydroinden-1-yl]-6-methylhept-6-enethioate (PubChem CID 11113485) has the molecular formula C28H40O2S2 and a molecular weight of 472.76 g/mol. Its IUPAC name is S-tert-butyl (2R)-2-[(5S,7aR)-5-hydroxy-7a-methyl-4-phenylsulfanyl-1,2,3,5,6,7-hexahydroinden-1-yl]-6-methylhept-6-enethioate.
| Compound Name | S-tert-butyl (2R)-2-[(5S,7aR)-5-hydroxy-7a-methyl-4-phenylsulfanyl-1,2,3,5,6,7-hexahydroinden-1-yl]-6-methylhept-6-enethioate |
|---|---|
| PubChem CID | 11113485 |
| Molecular Formula | C28H40O2S2 |
| Molecular Weight | 472.76 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | S-tert-butyl (2R)-2-[(5S,7aR)-5-hydroxy-7a-methyl-4-phenylsulfanyl-1,2,3,5,6,7-hexahydroinden-1-yl]-6-methylhept-6-enethioate |
| SMILES | C=C(C)CCC[C@@H](C(=O)SC(C)(C)C)C1CCC2=C(Sc3ccccc3)[C@@H](O)CC[C@@]21C |
| InChI | InChI=1S/C28H40O2S2/c1-19(2)11-10-14-21(26(30)32-27(3,4)5)22-15-16-23-25(24(29)17-18-28(22,23)6)31-20-12-8-7-9-13-20/h7-9,12-13,21-22,24,29H,1,10-11,14-18H2,2-6H3/t21-,22?,24+,28-/m1/s1 |
| InChIKey | ZVDJBFAPCHLIJJ-ZBEXEKQVSA-N |
| XLogP | 8.02 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.76 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|