C15H23NO3S — CID 11770962
methyl N-(4-hydroxy-5-methyl-5-phenylsulfanylhexyl)carbamate (PubChem CID 11770962) has the molecular formula C15H23NO3S and a molecular weight of 297.42 g/mol. Its IUPAC name is methyl N-(4-hydroxy-5-methyl-5-phenylsulfanylhexyl)carbamate.
| Compound Name | methyl N-(4-hydroxy-5-methyl-5-phenylsulfanylhexyl)carbamate |
|---|---|
| PubChem CID | 11770962 |
| Molecular Formula | C15H23NO3S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | methyl N-(4-hydroxy-5-methyl-5-phenylsulfanylhexyl)carbamate |
| SMILES | COC(=O)NCCCC(O)C(C)(C)Sc1ccccc1 |
| InChI | InChI=1S/C15H23NO3S/c1-15(2,20-12-8-5-4-6-9-12)13(17)10-7-11-16-14(18)19-3/h4-6,8-9,13,17H,7,10-11H2,1-3H3,(H,16,18) |
| InChIKey | SKVPFGFAOGDVGA-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|