C22H35NO4S — CID 11842914
tert-butyl 4-[(3-hydroxy-4-methyl-4-phenylsulfanylpentanoyl)amino]-4-methylpentanoate (PubChem CID 11842914) has the molecular formula C22H35NO4S and a molecular weight of 409.59 g/mol. Its IUPAC name is tert-butyl 4-[(3-hydroxy-4-methyl-4-phenylsulfanylpentanoyl)amino]-4-methylpentanoate.
| Compound Name | tert-butyl 4-[(3-hydroxy-4-methyl-4-phenylsulfanylpentanoyl)amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 11842914 |
| Molecular Formula | C22H35NO4S |
| Molecular Weight | 409.59 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | tert-butyl 4-[(3-hydroxy-4-methyl-4-phenylsulfanylpentanoyl)amino]-4-methylpentanoate |
| SMILES | CC(C)(CCC(=O)OC(C)(C)C)NC(=O)CC(O)C(C)(C)Sc1ccccc1 |
| InChI | InChI=1S/C22H35NO4S/c1-20(2,3)27-19(26)13-14-21(4,5)23-18(25)15-17(24)22(6,7)28-16-11-9-8-10-12-16/h8-12,17,24H,13-15H2,1-7H3,(H,23,25) |
| InChIKey | YDXRLUCOBGTHDR-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.59 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |