C22H26OS — CID 100929433
(3aS,5aS,8aR,8bS)-8b-(2-methylprop-2-enyl)-8-phenylsulfanyl-1,2,3,3a,4,5a,6,8a-octahydroacenaphthylen-5-one (PubChem CID 100929433) has the molecular formula C22H26OS and a molecular weight of 338.52 g/mol. Its IUPAC name is (3aS,5aS,8aR,8bS)-8b-(2-methylprop-2-enyl)-8-phenylsulfanyl-1,2,3,3a,4,5a,6,8a-octahydroacenaphthylen-5-one.
| Compound Name | (3aS,5aS,8aR,8bS)-8b-(2-methylprop-2-enyl)-8-phenylsulfanyl-1,2,3,3a,4,5a,6,8a-octahydroacenaphthylen-5-one |
|---|---|
| PubChem CID | 100929433 |
| Molecular Formula | C22H26OS |
| Molecular Weight | 338.52 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | (3aS,5aS,8aR,8bS)-8b-(2-methylprop-2-enyl)-8-phenylsulfanyl-1,2,3,3a,4,5a,6,8a-octahydroacenaphthylen-5-one |
| SMILES | C=C(C)C[C@]12[C@@H]3CCC(=O)[C@H]1CC=C(Sc1ccccc1)[C@@H]2CC3 |
| InChI | InChI=1S/C22H26OS/c1-15(2)14-22-16-8-10-19(22)21(24-17-6-4-3-5-7-17)13-11-18(22)20(23)12-9-16/h3-7,13,16,18-19H,1,8-12,14H2,2H3/t16-,18+,19-,22-/m0/s1 |
| InChIKey | PVBRGROOPVLUPD-ZBPHCFQXSA-N |
| XLogP | 6.02 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.52 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|