C31H44O4S2 — CID 10973607
S-tert-butyl (2R)-2-[(1R,7aR)-7a-methyl-5-oxo-4-phenylsulfanyl-2,3,6,7-tetrahydro-1H-inden-1-yl]-4-[(4S)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]butanethioate (PubChem CID 10973607) has the molecular formula C31H44O4S2 and a molecular weight of 544.82 g/mol. Its IUPAC name is S-tert-butyl (2R)-2-[(1R,7aR)-7a-methyl-5-oxo-4-phenylsulfanyl-2,3,6,7-tetrahydro-1H-inden-1-yl]-4-[(4S)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]butanethioate.
| Compound Name | S-tert-butyl (2R)-2-[(1R,7aR)-7a-methyl-5-oxo-4-phenylsulfanyl-2,3,6,7-tetrahydro-1H-inden-1-yl]-4-[(4S)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]butanethioate |
|---|---|
| PubChem CID | 10973607 |
| Molecular Formula | C31H44O4S2 |
| Molecular Weight | 544.82 g/mol |
| Exact Mass | 544.27 |
| IUPAC Name | S-tert-butyl (2R)-2-[(1R,7aR)-7a-methyl-5-oxo-4-phenylsulfanyl-2,3,6,7-tetrahydro-1H-inden-1-yl]-4-[(4S)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]butanethioate |
| SMILES | CC1(C)O[C@@H](CC[C@@H](C(=O)SC(C)(C)C)[C@H]2CCC3=C(Sc4ccccc4)C(=O)CC[C@@]32C)C(C)(C)O1 |
| InChI | InChI=1S/C31H44O4S2/c1-28(2,3)37-27(33)21(14-17-25-29(4,5)35-30(6,7)34-25)22-15-16-23-26(24(32)18-19-31(22,23)8)36-20-12-10-9-11-13-20/h9-13,21-22,25H,14-19H2,1-8H3/t21-,22-,25+,31-/m1/s1 |
| InChIKey | AJOWMRPZLYIQJW-TVGMPGEPSA-N |
| XLogP | 8.20 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.82 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|