C28H36O2S — CID 154089782
(8S,9S,10R,13S,14S,17S)-17-acetyl-10,13-dimethyl-4-(phenylsulfanylmethyl)-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 154089782) has the molecular formula C28H36O2S and a molecular weight of 436.66 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S,17S)-17-acetyl-10,13-dimethyl-4-(phenylsulfanylmethyl)-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9S,10R,13S,14S,17S)-17-acetyl-10,13-dimethyl-4-(phenylsulfanylmethyl)-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 154089782 |
| Molecular Formula | C28H36O2S |
| Molecular Weight | 436.66 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | (8S,9S,10R,13S,14S,17S)-17-acetyl-10,13-dimethyl-4-(phenylsulfanylmethyl)-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC(=O)[C@H]1CC[C@H]2[C@@H]3CCC4=C(CSc5ccccc5)C(=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C28H36O2S/c1-18(29)22-11-12-23-20-9-10-24-21(17-31-19-7-5-4-6-8-19)26(30)14-16-28(24,3)25(20)13-15-27(22,23)2/h4-8,20,22-23,25H,9-17H2,1-3H3/t20-,22+,23-,25-,27+,28-/m0/s1 |
| InChIKey | ALJQGGOQGSFKBT-NYNZKXGXSA-N |
| XLogP | 6.89 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.66 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |