C24H34O3S — CID 87844175
3-[(8S,9S,10R,13S,14S,17S)-17-acetyl-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-4-yl]propanethioic S-acid (PubChem CID 87844175) has the molecular formula C24H34O3S and a molecular weight of 402.60 g/mol. Its IUPAC name is 3-[(8S,9S,10R,13S,14S,17S)-17-acetyl-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-4-yl]propanethioic S-acid.
| Compound Name | 3-[(8S,9S,10R,13S,14S,17S)-17-acetyl-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-4-yl]propanethioic S-acid |
|---|---|
| PubChem CID | 87844175 |
| Molecular Formula | C24H34O3S |
| Molecular Weight | 402.60 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 3-[(8S,9S,10R,13S,14S,17S)-17-acetyl-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-4-yl]propanethioic S-acid |
| SMILES | CC(=O)[C@H]1CC[C@H]2[C@@H]3CCC4=C(CCC(=O)S)C(=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C24H34O3S/c1-14(25)17-7-8-18-15-4-6-19-16(5-9-22(27)28)21(26)11-13-24(19,3)20(15)10-12-23(17,18)2/h15,17-18,20H,4-13H2,1-3H3,(H,27,28)/t15-,17+,18-,20-,23+,24-/m0/s1 |
| InChIKey | HZEZMAHADFAVSL-KJBDTIBMSA-N |
| XLogP | 5.33 |
| TPSA | 51.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.60 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|