C26H39NO3S2 — CID 58855572
3-[(17-acetyl-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-4-yl)sulfanyl]-N-(2-sulfanylethyl)propanamide (PubChem CID 58855572) has the molecular formula C26H39NO3S2 and a molecular weight of 477.74 g/mol. Its IUPAC name is 3-[(17-acetyl-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-4-yl)sulfanyl]-N-(2-sulfanylethyl)propanamide.
| Compound Name | 3-[(17-acetyl-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-4-yl)sulfanyl]-N-(2-sulfanylethyl)propanamide |
|---|---|
| PubChem CID | 58855572 |
| Molecular Formula | C26H39NO3S2 |
| Molecular Weight | 477.74 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | 3-[(17-acetyl-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-4-yl)sulfanyl]-N-(2-sulfanylethyl)propanamide |
| SMILES | CC(=O)C1CCC2C3CCC4=C(SCCC(=O)NCCS)C(=O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C26H39NO3S2/c1-16(28)18-6-7-19-17-4-5-21-24(32-15-10-23(30)27-13-14-31)22(29)9-12-26(21,3)20(17)8-11-25(18,19)2/h17-20,31H,4-15H2,1-3H3,(H,27,30) |
| InChIKey | YNIDEBYPORDBHN-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.74 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|