C27H36O2S — CID 154089137
(8R,9S,10R,13S,14S,17S)-4-(benzylsulfanylmethyl)-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 154089137) has the molecular formula C27H36O2S and a molecular weight of 424.65 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S,17S)-4-(benzylsulfanylmethyl)-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9S,10R,13S,14S,17S)-4-(benzylsulfanylmethyl)-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 154089137 |
| Molecular Formula | C27H36O2S |
| Molecular Weight | 424.65 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | (8R,9S,10R,13S,14S,17S)-4-(benzylsulfanylmethyl)-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCC4=C(CSCc5ccccc5)C(=O)CC[C@@]43C)[C@@H]1CC[C@@H]2O |
| InChI | InChI=1S/C27H36O2S/c1-26-15-13-24(28)20(17-30-16-18-6-4-3-5-7-18)22(26)9-8-19-21-10-11-25(29)27(21,2)14-12-23(19)26/h3-7,19,21,23,25,29H,8-17H2,1-2H3/t19-,21-,23-,25-,26-,27-/m0/s1 |
| InChIKey | NIXNHQWJKLTRAA-QVVWPNSMSA-N |
| XLogP | 6.18 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.65 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |