C37H54O4Si — CID 10963003
(1S,7aS)-4-[3-[tert-butyl(diphenyl)silyl]oxypentyl]-1-[(2S)-1,4-dimethoxybutan-2-yl]-7a-methyl-2,3,6,7-tetrahydro-1H-inden-5-one (PubChem CID 10963003) has the molecular formula C37H54O4Si and a molecular weight of 590.92 g/mol. Its IUPAC name is (1S,7aS)-4-[3-[tert-butyl(diphenyl)silyl]oxypentyl]-1-[(2S)-1,4-dimethoxybutan-2-yl]-7a-methyl-2,3,6,7-tetrahydro-1H-inden-5-one.
| Compound Name | (1S,7aS)-4-[3-[tert-butyl(diphenyl)silyl]oxypentyl]-1-[(2S)-1,4-dimethoxybutan-2-yl]-7a-methyl-2,3,6,7-tetrahydro-1H-inden-5-one |
|---|---|
| PubChem CID | 10963003 |
| Molecular Formula | C37H54O4Si |
| Molecular Weight | 590.92 g/mol |
| Exact Mass | 590.38 |
| IUPAC Name | (1S,7aS)-4-[3-[tert-butyl(diphenyl)silyl]oxypentyl]-1-[(2S)-1,4-dimethoxybutan-2-yl]-7a-methyl-2,3,6,7-tetrahydro-1H-inden-5-one |
| SMILES | CCC(CCC1=C2CC[C@@H]([C@H](CCOC)COC)[C@]2(C)CCC1=O)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C37H54O4Si/c1-8-29(41-42(36(2,3)4,30-15-11-9-12-16-30)31-17-13-10-14-18-31)19-20-32-34-22-21-33(28(27-40-7)24-26-39-6)37(34,5)25-23-35(32)38/h9-18,28-29,33H,8,19-27H2,1-7H3/t28-,29?,33+,37+/m1/s1 |
| InChIKey | PELQOQITOAODCK-AHNSJISHSA-N |
| XLogP | 7.50 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.92 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|