C45H62O5Si — CID 19825331
2-[4-[3-[3-[tert-butyl(diphenyl)silyl]oxy-5-[3-[4-(2-hydroxypropan-2-yl)phenyl]propoxy]pentoxy]propyl]phenyl]propan-2-ol (PubChem CID 19825331) has the molecular formula C45H62O5Si and a molecular weight of 711.07 g/mol. Its IUPAC name is 2-[4-[3-[3-[tert-butyl(diphenyl)silyl]oxy-5-[3-[4-(2-hydroxypropan-2-yl)phenyl]propoxy]pentoxy]propyl]phenyl]propan-2-ol.
| Compound Name | 2-[4-[3-[3-[tert-butyl(diphenyl)silyl]oxy-5-[3-[4-(2-hydroxypropan-2-yl)phenyl]propoxy]pentoxy]propyl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 19825331 |
| Molecular Formula | C45H62O5Si |
| Molecular Weight | 711.07 g/mol |
| Exact Mass | 710.44 |
| IUPAC Name | 2-[4-[3-[3-[tert-butyl(diphenyl)silyl]oxy-5-[3-[4-(2-hydroxypropan-2-yl)phenyl]propoxy]pentoxy]propyl]phenyl]propan-2-ol |
| SMILES | CC(C)(O)c1ccc(CCCOCCC(CCOCCCc2ccc(C(C)(C)O)cc2)O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C45H62O5Si/c1-43(2,3)51(41-18-10-8-11-19-41,42-20-12-9-13-21-42)50-40(30-34-48-32-14-16-36-22-26-38(27-23-36)44(4,5)46)31-35-49-33-15-17-37-24-28-39(29-25-37)45(6,7)47/h8-13,18-29,40,46-47H,14-17,30-35H2,1-7H3 |
| InChIKey | TURFSEPJGLCPMA-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.07 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|