C17H24OS — CID 79227583
2-(2-phenylsulfanylethyl)-4-propylcyclohexan-1-one (PubChem CID 79227583) has the molecular formula C17H24OS and a molecular weight of 276.44 g/mol. Its IUPAC name is 2-(2-phenylsulfanylethyl)-4-propylcyclohexan-1-one.
| Compound Name | 2-(2-phenylsulfanylethyl)-4-propylcyclohexan-1-one |
|---|---|
| PubChem CID | 79227583 |
| Molecular Formula | C17H24OS |
| Molecular Weight | 276.44 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 2-(2-phenylsulfanylethyl)-4-propylcyclohexan-1-one |
| SMILES | CCCC1CCC(=O)C(CCSc2ccccc2)C1 |
| InChI | InChI=1S/C17H24OS/c1-2-6-14-9-10-17(18)15(13-14)11-12-19-16-7-4-3-5-8-16/h3-5,7-8,14-15H,2,6,9-13H2,1H3 |
| InChIKey | AHZLPBMBQZERDQ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.44 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |