C16H20ClFO — CID 55186341
2-[(2-chloro-6-fluorophenyl)methyl]-4-propylcyclohexan-1-one (PubChem CID 55186341) has the molecular formula C16H20ClFO and a molecular weight of 282.79 g/mol. Its IUPAC name is 2-[(2-chloro-6-fluorophenyl)methyl]-4-propylcyclohexan-1-one.
| Compound Name | 2-[(2-chloro-6-fluorophenyl)methyl]-4-propylcyclohexan-1-one |
|---|---|
| PubChem CID | 55186341 |
| Molecular Formula | C16H20ClFO |
| Molecular Weight | 282.79 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 2-[(2-chloro-6-fluorophenyl)methyl]-4-propylcyclohexan-1-one |
| SMILES | CCCC1CCC(=O)C(Cc2c(F)cccc2Cl)C1 |
| InChI | InChI=1S/C16H20ClFO/c1-2-4-11-7-8-16(19)12(9-11)10-13-14(17)5-3-6-15(13)18/h3,5-6,11-12H,2,4,7-10H2,1H3 |
| InChIKey | XZRFXLWUQUZCSP-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.79 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |