C29H30OS3 — CID 102268200
cis-(2S,3R)-2-(2-methylprop-2-enyl)-3-[tris(phenylsulfanyl)methyl]cyclohexan-1-one (PubChem CID 102268200) has the molecular formula C29H30OS3 and a molecular weight of 490.76 g/mol. Its IUPAC name is cis-(2S,3R)-2-(2-methylprop-2-enyl)-3-[tris(phenylsulfanyl)methyl]cyclohexan-1-one.
| Compound Name | cis-(2S,3R)-2-(2-methylprop-2-enyl)-3-[tris(phenylsulfanyl)methyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 102268200 |
| Molecular Formula | C29H30OS3 |
| Molecular Weight | 490.76 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | cis-(2S,3R)-2-(2-methylprop-2-enyl)-3-[tris(phenylsulfanyl)methyl]cyclohexan-1-one |
| SMILES | C=C(C)C[C@@H]1C(=O)CCC[C@H]1C(Sc1ccccc1)(Sc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C29H30OS3/c1-22(2)21-26-27(19-12-20-28(26)30)29(31-23-13-6-3-7-14-23,32-24-15-8-4-9-16-24)33-25-17-10-5-11-18-25/h3-11,13-18,26-27H,1,12,19-21H2,2H3/t26-,27+/m0/s1 |
| InChIKey | BMKFZBMJGAKGCD-RRPNLBNLSA-N |
| XLogP | 8.97 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.76 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|