C22H8F10OS2 — CID 86199480
2,2-bis[(2,3,4,5,6-pentafluorophenyl)sulfanyl]-3-phenylcyclobutan-1-one (PubChem CID 86199480) has the molecular formula C22H8F10OS2 and a molecular weight of 542.42 g/mol. Its IUPAC name is 2,2-bis[(2,3,4,5,6-pentafluorophenyl)sulfanyl]-3-phenylcyclobutan-1-one.
| Compound Name | 2,2-bis[(2,3,4,5,6-pentafluorophenyl)sulfanyl]-3-phenylcyclobutan-1-one |
|---|---|
| PubChem CID | 86199480 |
| Molecular Formula | C22H8F10OS2 |
| Molecular Weight | 542.42 g/mol |
| Exact Mass | 541.99 |
| IUPAC Name | 2,2-bis[(2,3,4,5,6-pentafluorophenyl)sulfanyl]-3-phenylcyclobutan-1-one |
| SMILES | O=C1CC(c2ccccc2)C1(Sc1c(F)c(F)c(F)c(F)c1F)Sc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C22H8F10OS2/c23-10-12(25)16(29)20(17(30)13(10)26)34-22(8(6-9(22)33)7-4-2-1-3-5-7)35-21-18(31)14(27)11(24)15(28)19(21)32/h1-5,8H,6H2 |
| InChIKey | MAEALIMQCRZNGP-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.42 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|