C15H9F5OS — CID 11404789
S-(2,3,4,5,6-pentafluorophenyl) 3-phenylpropanethioate (PubChem CID 11404789) has the molecular formula C15H9F5OS and a molecular weight of 332.29 g/mol. Its IUPAC name is S-(2,3,4,5,6-pentafluorophenyl) 3-phenylpropanethioate.
| Compound Name | S-(2,3,4,5,6-pentafluorophenyl) 3-phenylpropanethioate |
|---|---|
| PubChem CID | 11404789 |
| Molecular Formula | C15H9F5OS |
| Molecular Weight | 332.29 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | S-(2,3,4,5,6-pentafluorophenyl) 3-phenylpropanethioate |
| SMILES | O=C(CCc1ccccc1)Sc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C15H9F5OS/c16-10-11(17)13(19)15(14(20)12(10)18)22-9(21)7-6-8-4-2-1-3-5-8/h1-5H,6-7H2 |
| InChIKey | CVHCJSQSGBQMJZ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.29 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|