C27H28OS2 — CID 605199
4-(1,3-dithian-2-yl)-1,1,1-triphenylpentan-2-one (PubChem CID 605199) has the molecular formula C27H28OS2 and a molecular weight of 432.65 g/mol. Its IUPAC name is 4-(1,3-dithian-2-yl)-1,1,1-triphenylpentan-2-one.
| Compound Name | 4-(1,3-dithian-2-yl)-1,1,1-triphenylpentan-2-one |
|---|---|
| PubChem CID | 605199 |
| Molecular Formula | C27H28OS2 |
| Molecular Weight | 432.65 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 4-(1,3-dithian-2-yl)-1,1,1-triphenylpentan-2-one |
| SMILES | CC(CC(=O)C(c1ccccc1)(c1ccccc1)c1ccccc1)C1SCCCS1 |
| InChI | InChI=1S/C27H28OS2/c1-21(26-29-18-11-19-30-26)20-25(28)27(22-12-5-2-6-13-22,23-14-7-3-8-15-23)24-16-9-4-10-17-24/h2-10,12-17,21,26H,11,18-20H2,1H3 |
| InChIKey | VXRBNGUGQXEQEL-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.65 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|