C17H24OS2 — CID 46933422
1-(1,3-dithian-2-yl)-2-[4-(2-methylpropyl)phenyl]propan-1-one (PubChem CID 46933422) has the molecular formula C17H24OS2 and a molecular weight of 308.51 g/mol. Its IUPAC name is 1-(1,3-dithian-2-yl)-2-[4-(2-methylpropyl)phenyl]propan-1-one.
| Compound Name | 1-(1,3-dithian-2-yl)-2-[4-(2-methylpropyl)phenyl]propan-1-one |
|---|---|
| PubChem CID | 46933422 |
| Molecular Formula | C17H24OS2 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 1-(1,3-dithian-2-yl)-2-[4-(2-methylpropyl)phenyl]propan-1-one |
| SMILES | CC(C)Cc1ccc(C(C)C(=O)C2SCCCS2)cc1 |
| InChI | InChI=1S/C17H24OS2/c1-12(2)11-14-5-7-15(8-6-14)13(3)16(18)17-19-9-4-10-20-17/h5-8,12-13,17H,4,9-11H2,1-3H3 |
| InChIKey | MMUMATXYXOEJGR-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |