C18H22O — CID 11694523
cis-(2R,3S)-2-tert-butyl-3-(2-phenylethynyl)cyclohexan-1-one (PubChem CID 11694523) has the molecular formula C18H22O and a molecular weight of 254.37 g/mol. Its IUPAC name is cis-(2R,3S)-2-tert-butyl-3-(2-phenylethynyl)cyclohexan-1-one.
| Compound Name | cis-(2R,3S)-2-tert-butyl-3-(2-phenylethynyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 11694523 |
| Molecular Formula | C18H22O |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | cis-(2R,3S)-2-tert-butyl-3-(2-phenylethynyl)cyclohexan-1-one |
| SMILES | CC(C)(C)[C@@H]1C(=O)CCC[C@@H]1C#Cc1ccccc1 |
| InChI | InChI=1S/C18H22O/c1-18(2,3)17-15(10-7-11-16(17)19)13-12-14-8-5-4-6-9-14/h4-6,8-9,15,17H,7,10-11H2,1-3H3/t15-,17+/m1/s1 |
| InChIKey | XGRUQHJYAAKMCQ-WBVHZDCISA-N |
| XLogP | 4.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|