C14H19NO2 — CID 139692425
3-cyclohexyl-1,5,6,7-tetrahydrocyclopenta[b]pyridine-2,4-dione (PubChem CID 139692425) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is 3-cyclohexyl-1,5,6,7-tetrahydrocyclopenta[b]pyridine-2,4-dione.
| Compound Name | 3-cyclohexyl-1,5,6,7-tetrahydrocyclopenta[b]pyridine-2,4-dione |
|---|---|
| PubChem CID | 139692425 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 3-cyclohexyl-1,5,6,7-tetrahydrocyclopenta[b]pyridine-2,4-dione |
| SMILES | O=C1NC2=C(CCC2)C(=O)C1C1CCCCC1 |
| InChI | InChI=1S/C14H19NO2/c16-13-10-7-4-8-11(10)15-14(17)12(13)9-5-2-1-3-6-9/h9,12H,1-8H2,(H,15,17) |
| InChIKey | UTOHOXWVJOBYTH-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|