C8H12NOS- — CID 59791699
4-methanidyl-5,6,7,7a-tetrahydro-3aH-thieno[3,2-b]pyridin-3-one (PubChem CID 59791699) has the molecular formula C8H12NOS- and a molecular weight of 170.26 g/mol. Its IUPAC name is 4-methanidyl-5,6,7,7a-tetrahydro-3aH-thieno[3,2-b]pyridin-3-one.
| Compound Name | 4-methanidyl-5,6,7,7a-tetrahydro-3aH-thieno[3,2-b]pyridin-3-one |
|---|---|
| PubChem CID | 59791699 |
| Molecular Formula | C8H12NOS- |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | 4-methanidyl-5,6,7,7a-tetrahydro-3aH-thieno[3,2-b]pyridin-3-one |
| SMILES | [CH2-]N1CCCC2SCC(=O)C21 |
| InChI | InChI=1S/C8H12NOS/c1-9-4-2-3-7-8(9)6(10)5-11-7/h7-8H,1-5H2/q-1 |
| InChIKey | HIDCFUPQFYGDEX-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|