C7H9NO2S — CID 70585843
(8aS)-6,7,8,8a-tetrahydropyrrolo[2,1-c][1,4]thiazine-1,4-dione (PubChem CID 70585843) has the molecular formula C7H9NO2S and a molecular weight of 171.22 g/mol. Its IUPAC name is (8aS)-6,7,8,8a-tetrahydropyrrolo[2,1-c][1,4]thiazine-1,4-dione.
| Compound Name | (8aS)-6,7,8,8a-tetrahydropyrrolo[2,1-c][1,4]thiazine-1,4-dione |
|---|---|
| PubChem CID | 70585843 |
| Molecular Formula | C7H9NO2S |
| Molecular Weight | 171.22 g/mol |
| Exact Mass | 171.04 |
| IUPAC Name | (8aS)-6,7,8,8a-tetrahydropyrrolo[2,1-c][1,4]thiazine-1,4-dione |
| SMILES | O=C1SCC(=O)N2CCC[C@@H]12 |
| InChI | InChI=1S/C7H9NO2S/c9-6-4-11-7(10)5-2-1-3-8(5)6/h5H,1-4H2/t5-/m0/s1 |
| InChIKey | ZZBLXLJJJFKYFR-YFKPBYRVSA-N |
| XLogP | 0.25 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.22 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|