C11H16N2O — CID 70296352
(8aS)-1-cyclobutylidene-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one (PubChem CID 70296352) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is (8aS)-1-cyclobutylidene-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one.
| Compound Name | (8aS)-1-cyclobutylidene-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one |
|---|---|
| PubChem CID | 70296352 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | (8aS)-1-cyclobutylidene-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one |
| SMILES | O=C1CNC(=C2CCC2)[C@@H]2CCCN12 |
| InChI | InChI=1S/C11H16N2O/c14-10-7-12-11(8-3-1-4-8)9-5-2-6-13(9)10/h9,12H,1-7H2/t9-/m0/s1 |
| InChIKey | VLTQYLLGYVMBTN-VIFPVBQESA-N |
| XLogP | 1.02 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |