About (3R,10S)-1,8-diazatricyclo[8.4.0.03,8]tetradecane-2,9-dione
(3R,10S)-1,8-diazatricyclo[8.4.0.03,8]tetradecane-2,9-dione (PubChem CID 97436024) has the molecular formula C12H18N2O2
and a molecular weight of 222.29 g/mol. Its IUPAC name is (3R,10S)-1,8-diazatricyclo[8.4.0.03,8]tetradecane-2,9-dione.
Analyze (3R,10S)-1,8-diazatricyclo[8.4.0.03,8]tetradecane-2,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,10S)-1,8-diazatricyclo[8.4.0.03,8]tetradecane-2,9-dione?
The IUPAC name of (3R,10S)-1,8-diazatricyclo[8.4.0.03,8]tetradecane-2,9-dione (CID 97436024) is (3R,10S)-1,8-diazatricyclo[8.4.0.03,8]tetradecane-2,9-dione.
What is the SMILES notation for (3R,10S)-1,8-diazatricyclo[8.4.0.03,8]tetradecane-2,9-dione?
The canonical SMILES for (3R,10S)-1,8-diazatricyclo[8.4.0.03,8]tetradecane-2,9-dione is O=C1[C@@H]2CCCCN2C(=O)[C@H]2CCCCN12.
What is the InChIKey of (3R,10S)-1,8-diazatricyclo[8.4.0.03,8]tetradecane-2,9-dione?
The InChIKey is DVUOUKHMQDFLFQ-AOOOYVTPSA-N. The full InChI is InChI=1S/C12H18N2O2/c15-11-9-5-1-3-7-13(9)12(16)10-6-2-4-8-14(10)11/h9-10H,1-8H2/t9-,10+.
What are the key properties of (3R,10S)-1,8-diazatricyclo[8.4.0.03,8]tetradecane-2,9-dione?
(3R,10S)-1,8-diazatricyclo[8.4.0.03,8]tetradecane-2,9-dione has a molecular weight of 222.29 g/mol, XLogP of 0.76, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,10S)-1,8-diazatricyclo[8.4.0.03,8]tetradecane-2,9-dione is sourced from PubChem (CID 97436024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).