C10H15NO2 — CID 139702649
2-ethyl-6,7,8,8a-tetrahydro-5H-indolizine-1,3-dione (PubChem CID 139702649) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is 2-ethyl-6,7,8,8a-tetrahydro-5H-indolizine-1,3-dione.
| Compound Name | 2-ethyl-6,7,8,8a-tetrahydro-5H-indolizine-1,3-dione |
|---|---|
| PubChem CID | 139702649 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 2-ethyl-6,7,8,8a-tetrahydro-5H-indolizine-1,3-dione |
| SMILES | CCC1C(=O)C2CCCCN2C1=O |
| InChI | InChI=1S/C10H15NO2/c1-2-7-9(12)8-5-3-4-6-11(8)10(7)13/h7-8H,2-6H2,1H3 |
| InChIKey | NPGCRVRIWRXZNG-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|