C14H24N2O2 — CID 79932366
2-tert-butyl-3-ethyl-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazine-1,4-dione (PubChem CID 79932366) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 2-tert-butyl-3-ethyl-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazine-1,4-dione.
| Compound Name | 2-tert-butyl-3-ethyl-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 79932366 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | 2-tert-butyl-3-ethyl-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazine-1,4-dione |
| SMILES | CCC1C(=O)N2CCCCC2C(=O)N1C(C)(C)C |
| InChI | InChI=1S/C14H24N2O2/c1-5-10-12(17)15-9-7-6-8-11(15)13(18)16(10)14(2,3)4/h10-11H,5-9H2,1-4H3 |
| InChIKey | POTSFHBJCNPVHT-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |