C9H14OS2 — CID 177395484
2,3,5,5a,7,8,9,9a-octahydrobenzo[e][1,4]dithiepin-6-one (PubChem CID 177395484) has the molecular formula C9H14OS2 and a molecular weight of 202.34 g/mol. Its IUPAC name is 2,3,5,5a,7,8,9,9a-octahydrobenzo[e][1,4]dithiepin-6-one.
| Compound Name | 2,3,5,5a,7,8,9,9a-octahydrobenzo[e][1,4]dithiepin-6-one |
|---|---|
| PubChem CID | 177395484 |
| Molecular Formula | C9H14OS2 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | 2,3,5,5a,7,8,9,9a-octahydrobenzo[e][1,4]dithiepin-6-one |
| SMILES | O=C1CCCC2SCCSCC12 |
| InChI | InChI=1S/C9H14OS2/c10-8-2-1-3-9-7(8)6-11-4-5-12-9/h7,9H,1-6H2 |
| InChIKey | ZYHCDOSZQYRVKM-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |