C7H10OS2 — CID 134937197
2-(1,3-dithiolan-2-yl)cyclobutan-1-one (PubChem CID 134937197) has the molecular formula C7H10OS2 and a molecular weight of 174.29 g/mol. Its IUPAC name is 2-(1,3-dithiolan-2-yl)cyclobutan-1-one.
| Compound Name | 2-(1,3-dithiolan-2-yl)cyclobutan-1-one |
|---|---|
| PubChem CID | 134937197 |
| Molecular Formula | C7H10OS2 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.02 |
| IUPAC Name | 2-(1,3-dithiolan-2-yl)cyclobutan-1-one |
| SMILES | O=C1CCC1C1SCCS1 |
| InChI | InChI=1S/C7H10OS2/c8-6-2-1-5(6)7-9-3-4-10-7/h5,7H,1-4H2 |
| InChIKey | WFLSDQZORONINP-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |