C6H8Br2O — CID 11780109
cis-(2S,3S)-2,3-dibromocyclohexan-1-one (PubChem CID 11780109) has the molecular formula C6H8Br2O and a molecular weight of 255.94 g/mol. Its IUPAC name is cis-(2S,3S)-2,3-dibromocyclohexan-1-one.
| Compound Name | cis-(2S,3S)-2,3-dibromocyclohexan-1-one |
|---|---|
| PubChem CID | 11780109 |
| Molecular Formula | C6H8Br2O |
| Molecular Weight | 255.94 g/mol |
| Exact Mass | 253.89 |
| IUPAC Name | cis-(2S,3S)-2,3-dibromocyclohexan-1-one |
| SMILES | O=C1CCC[C@H](Br)[C@H]1Br |
| InChI | InChI=1S/C6H8Br2O/c7-4-2-1-3-5(9)6(4)8/h4,6H,1-3H2/t4-,6+/m0/s1 |
| InChIKey | PBAKYHHBZPQVOE-UJURSFKZSA-N |
| XLogP | 2.27 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.94 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|