C9H14N2O — CID 90994195
3-imino-2-methyl-3a,4,5,6,7,7a-hexahydroisoindol-1-one (PubChem CID 90994195) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is 3-imino-2-methyl-3a,4,5,6,7,7a-hexahydroisoindol-1-one.
| Compound Name | 3-imino-2-methyl-3a,4,5,6,7,7a-hexahydroisoindol-1-one |
|---|---|
| PubChem CID | 90994195 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 3-imino-2-methyl-3a,4,5,6,7,7a-hexahydroisoindol-1-one |
| SMILES | [H]/N=C1/C2CCCCC2C(=O)N1C |
| InChI | InChI=1S/C9H14N2O/c1-11-8(10)6-4-2-3-5-7(6)9(11)12/h6-7,10H,2-5H2,1H3/b10-8- |
| InChIKey | OKGIDLFJNUASHG-NTMALXAHSA-N |
| XLogP | 1.24 |
| TPSA | 44.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|