C6H12N2 — CID 154249438
1,3-dimethylpyrrolidin-2-imine (PubChem CID 154249438) has the molecular formula C6H12N2 and a molecular weight of 112.18 g/mol. Its IUPAC name is 1,3-dimethylpyrrolidin-2-imine.
| Compound Name | 1,3-dimethylpyrrolidin-2-imine |
|---|---|
| PubChem CID | 154249438 |
| Molecular Formula | C6H12N2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | 1,3-dimethylpyrrolidin-2-imine |
| SMILES | [H]/N=C1/C(C)CCN1C |
| InChI | InChI=1S/C6H12N2/c1-5-3-4-8(2)6(5)7/h5,7H,3-4H2,1-2H3/b7-6- |
| InChIKey | KILFDSZZBGERNF-SREVYHEPSA-N |
| XLogP | 0.94 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|