C7H13N3O — CID 56636476
1,3-dimethyl-5-nitrosopiperidin-2-imine (PubChem CID 56636476) has the molecular formula C7H13N3O and a molecular weight of 155.20 g/mol. Its IUPAC name is 1,3-dimethyl-5-nitrosopiperidin-2-imine.
| Compound Name | 1,3-dimethyl-5-nitrosopiperidin-2-imine |
|---|---|
| PubChem CID | 56636476 |
| Molecular Formula | C7H13N3O |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | 1,3-dimethyl-5-nitrosopiperidin-2-imine |
| SMILES | [H]/N=C1\C(C)CC(N=O)CN1C |
| InChI | InChI=1S/C7H13N3O/c1-5-3-6(9-11)4-10(2)7(5)8/h5-6,8H,3-4H2,1-2H3/b8-7+ |
| InChIKey | VQWBZYIEIKRCBX-BQYQJAHWSA-N |
| XLogP | 1.07 |
| TPSA | 56.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|