C11H22N4 — CID 56622563
2-[(6-imino-1,5-dimethylpiperidin-3-ylidene)amino]-N,N-dimethylethanamine (PubChem CID 56622563) has the molecular formula C11H22N4 and a molecular weight of 210.32 g/mol. Its IUPAC name is 2-[(6-imino-1,5-dimethylpiperidin-3-ylidene)amino]-N,N-dimethylethanamine.
| Compound Name | 2-[(6-imino-1,5-dimethylpiperidin-3-ylidene)amino]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 56622563 |
| Molecular Formula | C11H22N4 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.18 |
| IUPAC Name | 2-[(6-imino-1,5-dimethylpiperidin-3-ylidene)amino]-N,N-dimethylethanamine |
| SMILES | [H]/N=C1\C(C)C/C(=N/CCN(C)C)CN1C |
| InChI | InChI=1S/C11H22N4/c1-9-7-10(8-15(4)11(9)12)13-5-6-14(2)3/h9,12H,5-8H2,1-4H3/b12-11+,13-10- |
| InChIKey | WQIZLRDYZQNLQN-NXDNQHQTSA-N |
| XLogP | 0.94 |
| TPSA | 42.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|