C10H22BrN5O2P+ — CID 11987545
2-bromo-2-[2-(dimethylamino)ethyl-methylamino]-1,3,5-trimethyl-1,3,5,2-triazaphosphinan-2-ium-4,6-dione (PubChem CID 11987545) has the molecular formula C10H22BrN5O2P+ and a molecular weight of 355.20 g/mol. Its IUPAC name is 2-bromo-2-[2-(dimethylamino)ethyl-methylamino]-1,3,5-trimethyl-1,3,5,2-triazaphosphinan-2-ium-4,6-dione.
| Compound Name | 2-bromo-2-[2-(dimethylamino)ethyl-methylamino]-1,3,5-trimethyl-1,3,5,2-triazaphosphinan-2-ium-4,6-dione |
|---|---|
| PubChem CID | 11987545 |
| Molecular Formula | C10H22BrN5O2P+ |
| Molecular Weight | 355.20 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 2-bromo-2-[2-(dimethylamino)ethyl-methylamino]-1,3,5-trimethyl-1,3,5,2-triazaphosphinan-2-ium-4,6-dione |
| SMILES | CN(C)CCN(C)[P+]1(Br)N(C)C(=O)N(C)C(=O)N1C |
| InChI | InChI=1S/C10H22BrN5O2P/c1-12(2)7-8-13(3)19(11)15(5)9(17)14(4)10(18)16(19)6/h7-8H2,1-6H3/q+1 |
| InChIKey | FYKNWAYRUIYZFC-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 50.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.20 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|