C6H10N2O3 — CID 54568604
4,6-dimethyl-2-nitrosomorpholin-3-one (PubChem CID 54568604) has the molecular formula C6H10N2O3 and a molecular weight of 158.16 g/mol. Its IUPAC name is 4,6-dimethyl-2-nitrosomorpholin-3-one.
| Compound Name | 4,6-dimethyl-2-nitrosomorpholin-3-one |
|---|---|
| PubChem CID | 54568604 |
| Molecular Formula | C6H10N2O3 |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | 4,6-dimethyl-2-nitrosomorpholin-3-one |
| SMILES | CC1CN(C)C(=O)C(N=O)O1 |
| InChI | InChI=1S/C6H10N2O3/c1-4-3-8(2)6(9)5(7-10)11-4/h4-5H,3H2,1-2H3 |
| InChIKey | ZVPRCRHFAGENCF-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |