C9H21NO — CID 142013694
ethane;(2S,6R)-2,4,6-trimethylmorpholine (PubChem CID 142013694) has the molecular formula C9H21NO and a molecular weight of 159.27 g/mol. Its IUPAC name is ethane;(2S,6R)-2,4,6-trimethylmorpholine.
| Compound Name | ethane;(2S,6R)-2,4,6-trimethylmorpholine |
|---|---|
| PubChem CID | 142013694 |
| Molecular Formula | C9H21NO |
| Molecular Weight | 159.27 g/mol |
| Exact Mass | 159.16 |
| IUPAC Name | ethane;(2S,6R)-2,4,6-trimethylmorpholine |
| SMILES | CC.C[C@@H]1CN(C)C[C@H](C)O1 |
| InChI | InChI=1S/C7H15NO.C2H6/c1-6-4-8(3)5-7(2)9-6;1-2/h6-7H,4-5H2,1-3H3;1-2H3/t6-,7+; |
| InChIKey | WTMIKRLXJYRAPU-UKMDXRBESA-N |
| XLogP | 1.75 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.27 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |